C24H33O6P — CID 18515293
[2,4-bis[(2-methylpropan-2-yl)oxy]phenyl]phosphanyl-(2,4,6-trimethoxyphenyl)methanone (PubChem CID 18515293) has the molecular formula C24H33O6P and a molecular weight of 448.50 g/mol. Its IUPAC name is [2,4-bis[(2-methylpropan-2-yl)oxy]phenyl]phosphanyl-(2,4,6-trimethoxyphenyl)methanone.
| Compound Name | [2,4-bis[(2-methylpropan-2-yl)oxy]phenyl]phosphanyl-(2,4,6-trimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 18515293 |
| Molecular Formula | C24H33O6P |
| Molecular Weight | 448.50 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | [2,4-bis[(2-methylpropan-2-yl)oxy]phenyl]phosphanyl-(2,4,6-trimethoxyphenyl)methanone |
| SMILES | COc1cc(OC)c(C(=O)Pc2ccc(OC(C)(C)C)cc2OC(C)(C)C)c(OC)c1 |
| InChI | InChI=1S/C24H33O6P/c1-23(2,3)29-15-10-11-20(17(12-15)30-24(4,5)6)31-22(25)21-18(27-8)13-16(26-7)14-19(21)28-9/h10-14,31H,1-9H3 |
| InChIKey | YCTYEKOSVOKNIO-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.50 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|