C28H42LiO7P — CID 173245466
lithium;hydride;(2,4,6-trimethoxyphenyl)-[2,4,6-tris[(2-methylpropan-2-yl)oxy]phenyl]phosphanylmethanone (PubChem CID 173245466) has the molecular formula C28H42LiO7P and a molecular weight of 528.55 g/mol. Its IUPAC name is lithium;hydride;(2,4,6-trimethoxyphenyl)-[2,4,6-tris[(2-methylpropan-2-yl)oxy]phenyl]phosphanylmethanone.
| Compound Name | lithium;hydride;(2,4,6-trimethoxyphenyl)-[2,4,6-tris[(2-methylpropan-2-yl)oxy]phenyl]phosphanylmethanone |
|---|---|
| PubChem CID | 173245466 |
| Molecular Formula | C28H42LiO7P |
| Molecular Weight | 528.55 g/mol |
| Exact Mass | 528.28 |
| IUPAC Name | lithium;hydride;(2,4,6-trimethoxyphenyl)-[2,4,6-tris[(2-methylpropan-2-yl)oxy]phenyl]phosphanylmethanone |
| SMILES | COc1cc(OC)c(C(=O)Pc2c(OC(C)(C)C)cc(OC(C)(C)C)cc2OC(C)(C)C)c(OC)c1.[H-].[Li+] |
| InChI | InChI=1S/C28H41O7P.Li.H/c1-26(2,3)33-18-15-21(34-27(4,5)6)24(22(16-18)35-28(7,8)9)36-25(29)23-19(31-11)13-17(30-10)14-20(23)32-12;;/h13-16,36H,1-12H3;;/q;+1;-1 |
| InChIKey | RJKJLUQLFFGNGZ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.55 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|