C21H27LiO3P — CID 70014312
CID 70014312 (PubChem CID 70014312) has the molecular formula C21H27LiO3P and a molecular weight of 365.36 g/mol.
| Compound Name | CID 70014312 |
|---|---|
| PubChem CID | 70014312 |
| Molecular Formula | C21H27LiO3P |
| Molecular Weight | 365.36 g/mol |
| Exact Mass | 365.19 |
| IUPAC Name | — |
| SMILES | COc1ccc(PC(=O)c2c(C)cc(C(C)(C)C)cc2C)c(OC)c1.[Li] |
| InChI | InChI=1S/C21H27O3P.Li/c1-13-10-15(21(3,4)5)11-14(2)19(13)20(22)25-18-9-8-16(23-6)12-17(18)24-7;/h8-12,25H,1-7H3; |
| InChIKey | BBSSJIKWEJEIIS-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.36 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|