C33H31O5P — CID 139895712
[3-benzoyloxy-4-(4-tert-butyl-2,6-dimethylbenzoyl)phosphanylphenyl] benzoate (PubChem CID 139895712) has the molecular formula C33H31O5P and a molecular weight of 538.58 g/mol. Its IUPAC name is [3-benzoyloxy-4-(4-tert-butyl-2,6-dimethylbenzoyl)phosphanylphenyl] benzoate.
| Compound Name | [3-benzoyloxy-4-(4-tert-butyl-2,6-dimethylbenzoyl)phosphanylphenyl] benzoate |
|---|---|
| PubChem CID | 139895712 |
| Molecular Formula | C33H31O5P |
| Molecular Weight | 538.58 g/mol |
| Exact Mass | 538.19 |
| IUPAC Name | [3-benzoyloxy-4-(4-tert-butyl-2,6-dimethylbenzoyl)phosphanylphenyl] benzoate |
| SMILES | Cc1cc(C(C)(C)C)cc(C)c1C(=O)Pc1ccc(OC(=O)c2ccccc2)cc1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C33H31O5P/c1-21-18-25(33(3,4)5)19-22(2)29(21)32(36)39-28-17-16-26(37-30(34)23-12-8-6-9-13-23)20-27(28)38-31(35)24-14-10-7-11-15-24/h6-20,39H,1-5H3 |
| InChIKey | SVWNBKCSUBUGPB-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.58 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|