C24H33LiO2P — CID 70014164
CID 70014164 (PubChem CID 70014164) has the molecular formula C24H33LiO2P and a molecular weight of 391.44 g/mol.
| Compound Name | CID 70014164 |
|---|---|
| PubChem CID | 70014164 |
| Molecular Formula | C24H33LiO2P |
| Molecular Weight | 391.44 g/mol |
| Exact Mass | 391.24 |
| IUPAC Name | — |
| SMILES | CCCCOc1ccc(PC(=O)c2c(C)cc(C(C)(C)C)cc2C)c(C)c1.[Li] |
| InChI | InChI=1S/C24H33O2P.Li/c1-8-9-12-26-20-10-11-21(16(2)15-20)27-23(25)22-17(3)13-19(14-18(22)4)24(5,6)7;/h10-11,13-15,27H,8-9,12H2,1-7H3; |
| InChIKey | XHDKTLDCYFRNHL-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.44 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|