C19H23ClLiO3P — CID 173244447
lithium;(4-butoxy-2-methylphenyl)phosphanyl-(2-chloro-6-methoxyphenyl)methanone;hydride (PubChem CID 173244447) has the molecular formula C19H23ClLiO3P and a molecular weight of 372.76 g/mol. Its IUPAC name is lithium;(4-butoxy-2-methylphenyl)phosphanyl-(2-chloro-6-methoxyphenyl)methanone;hydride.
| Compound Name | lithium;(4-butoxy-2-methylphenyl)phosphanyl-(2-chloro-6-methoxyphenyl)methanone;hydride |
|---|---|
| PubChem CID | 173244447 |
| Molecular Formula | C19H23ClLiO3P |
| Molecular Weight | 372.76 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | lithium;(4-butoxy-2-methylphenyl)phosphanyl-(2-chloro-6-methoxyphenyl)methanone;hydride |
| SMILES | CCCCOc1ccc(PC(=O)c2c(Cl)cccc2OC)c(C)c1.[H-].[Li+] |
| InChI | InChI=1S/C19H22ClO3P.Li.H/c1-4-5-11-23-14-9-10-17(13(2)12-14)24-19(21)18-15(20)7-6-8-16(18)22-3;;/h6-10,12,24H,4-5,11H2,1-3H3;;/q;+1;-1 |
| InChIKey | WVZYUJLHRBBELS-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.76 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|