C24H34LiO2P — CID 173244590
lithium;(4-hexoxy-2-methylphenyl)phosphanyl-(2,3,4,6-tetramethylphenyl)methanone;hydride (PubChem CID 173244590) has the molecular formula C24H34LiO2P and a molecular weight of 392.45 g/mol. Its IUPAC name is lithium;(4-hexoxy-2-methylphenyl)phosphanyl-(2,3,4,6-tetramethylphenyl)methanone;hydride.
| Compound Name | lithium;(4-hexoxy-2-methylphenyl)phosphanyl-(2,3,4,6-tetramethylphenyl)methanone;hydride |
|---|---|
| PubChem CID | 173244590 |
| Molecular Formula | C24H34LiO2P |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.25 |
| IUPAC Name | lithium;(4-hexoxy-2-methylphenyl)phosphanyl-(2,3,4,6-tetramethylphenyl)methanone;hydride |
| SMILES | CCCCCCOc1ccc(PC(=O)c2c(C)cc(C)c(C)c2C)c(C)c1.[H-].[Li+] |
| InChI | InChI=1S/C24H33O2P.Li.H/c1-7-8-9-10-13-26-21-11-12-22(17(3)15-21)27-24(25)23-18(4)14-16(2)19(5)20(23)6;;/h11-12,14-15,27H,7-10,13H2,1-6H3;;/q;+1;-1 |
| InChIKey | BYBSEQSLFBINLA-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|