C23H31LiO2P+ — CID 18515180
lithium [2-methyl-4-(3-methylbutoxy)phenyl]phosphanyl-(2,3,4,6-tetramethylphenyl)methanone (PubChem CID 18515180) has the molecular formula C23H31LiO2P+ and a molecular weight of 377.41 g/mol. Its IUPAC name is lithium [2-methyl-4-(3-methylbutoxy)phenyl]phosphanyl-(2,3,4,6-tetramethylphenyl)methanone.
| Compound Name | lithium [2-methyl-4-(3-methylbutoxy)phenyl]phosphanyl-(2,3,4,6-tetramethylphenyl)methanone |
|---|---|
| PubChem CID | 18515180 |
| Molecular Formula | C23H31LiO2P+ |
| Molecular Weight | 377.41 g/mol |
| Exact Mass | 377.22 |
| IUPAC Name | lithium [2-methyl-4-(3-methylbutoxy)phenyl]phosphanyl-(2,3,4,6-tetramethylphenyl)methanone |
| SMILES | Cc1cc(OCCC(C)C)ccc1PC(=O)c1c(C)cc(C)c(C)c1C.[Li+] |
| InChI | InChI=1S/C23H31O2P.Li/c1-14(2)10-11-25-20-8-9-21(16(4)13-20)26-23(24)22-17(5)12-15(3)18(6)19(22)7;/h8-9,12-14,26H,10-11H2,1-7H3;/q;+1 |
| InChIKey | WLRFGAWVJPFQQO-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.41 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|