C23H29Cl2O3P — CID 18513831
(2,6-dichlorophenyl)-(2,4-dipentoxyphenyl)phosphanylmethanone (PubChem CID 18513831) has the molecular formula C23H29Cl2O3P and a molecular weight of 455.36 g/mol. Its IUPAC name is (2,6-dichlorophenyl)-(2,4-dipentoxyphenyl)phosphanylmethanone.
| Compound Name | (2,6-dichlorophenyl)-(2,4-dipentoxyphenyl)phosphanylmethanone |
|---|---|
| PubChem CID | 18513831 |
| Molecular Formula | C23H29Cl2O3P |
| Molecular Weight | 455.36 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | (2,6-dichlorophenyl)-(2,4-dipentoxyphenyl)phosphanylmethanone |
| SMILES | CCCCCOc1ccc(PC(=O)c2c(Cl)cccc2Cl)c(OCCCCC)c1 |
| InChI | InChI=1S/C23H29Cl2O3P/c1-3-5-7-14-27-17-12-13-21(20(16-17)28-15-8-6-4-2)29-23(26)22-18(24)10-9-11-19(22)25/h9-13,16,29H,3-8,14-15H2,1-2H3 |
| InChIKey | SJOQDBKQEAECCC-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.36 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|