C21H28LiO7P — CID 173245168
lithium;[2,4-bis(2-methoxyethoxy)phenyl]phosphanyl-(2,6-dimethoxyphenyl)methanone;hydride (PubChem CID 173245168) has the molecular formula C21H28LiO7P and a molecular weight of 430.36 g/mol. Its IUPAC name is lithium;[2,4-bis(2-methoxyethoxy)phenyl]phosphanyl-(2,6-dimethoxyphenyl)methanone;hydride.
| Compound Name | lithium;[2,4-bis(2-methoxyethoxy)phenyl]phosphanyl-(2,6-dimethoxyphenyl)methanone;hydride |
|---|---|
| PubChem CID | 173245168 |
| Molecular Formula | C21H28LiO7P |
| Molecular Weight | 430.36 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | lithium;[2,4-bis(2-methoxyethoxy)phenyl]phosphanyl-(2,6-dimethoxyphenyl)methanone;hydride |
| SMILES | COCCOc1ccc(PC(=O)c2c(OC)cccc2OC)c(OCCOC)c1.[H-].[Li+] |
| InChI | InChI=1S/C21H27O7P.Li.H/c1-23-10-12-27-15-8-9-19(18(14-15)28-13-11-24-2)29-21(22)20-16(25-3)6-5-7-17(20)26-4;;/h5-9,14,29H,10-13H2,1-4H3;;/q;+1;-1 |
| InChIKey | HOCZOSXNEKAMJI-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.36 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|