C19H24LiO5P — CID 173244606
lithium;(2,6-dimethoxyphenyl)-[4-(1-ethoxyethoxy)phenyl]phosphanylmethanone;hydride (PubChem CID 173244606) has the molecular formula C19H24LiO5P and a molecular weight of 370.31 g/mol. Its IUPAC name is lithium;(2,6-dimethoxyphenyl)-[4-(1-ethoxyethoxy)phenyl]phosphanylmethanone;hydride.
| Compound Name | lithium;(2,6-dimethoxyphenyl)-[4-(1-ethoxyethoxy)phenyl]phosphanylmethanone;hydride |
|---|---|
| PubChem CID | 173244606 |
| Molecular Formula | C19H24LiO5P |
| Molecular Weight | 370.31 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | lithium;(2,6-dimethoxyphenyl)-[4-(1-ethoxyethoxy)phenyl]phosphanylmethanone;hydride |
| SMILES | CCOC(C)Oc1ccc(PC(=O)c2c(OC)cccc2OC)cc1.[H-].[Li+] |
| InChI | InChI=1S/C19H23O5P.Li.H/c1-5-23-13(2)24-14-9-11-15(12-10-14)25-19(20)18-16(21-3)7-6-8-17(18)22-4;;/h6-13,25H,5H2,1-4H3;;/q;+1;-1 |
| InChIKey | WHYVGYUPZHYUKC-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.31 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|