C18H21ClLiO4P — CID 173245926
lithium;(2-chloro-6-methoxyphenyl)-[4-(2-ethoxyethoxy)phenyl]phosphanylmethanone;hydride (PubChem CID 173245926) has the molecular formula C18H21ClLiO4P and a molecular weight of 374.73 g/mol. Its IUPAC name is lithium;(2-chloro-6-methoxyphenyl)-[4-(2-ethoxyethoxy)phenyl]phosphanylmethanone;hydride.
| Compound Name | lithium;(2-chloro-6-methoxyphenyl)-[4-(2-ethoxyethoxy)phenyl]phosphanylmethanone;hydride |
|---|---|
| PubChem CID | 173245926 |
| Molecular Formula | C18H21ClLiO4P |
| Molecular Weight | 374.73 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | lithium;(2-chloro-6-methoxyphenyl)-[4-(2-ethoxyethoxy)phenyl]phosphanylmethanone;hydride |
| SMILES | CCOCCOc1ccc(PC(=O)c2c(Cl)cccc2OC)cc1.[H-].[Li+] |
| InChI | InChI=1S/C18H20ClO4P.Li.H/c1-3-22-11-12-23-13-7-9-14(10-8-13)24-18(20)17-15(19)5-4-6-16(17)21-2;;/h4-10,24H,3,11-12H2,1-2H3;;/q;+1;-1 |
| InChIKey | SFKXTASGTYLXPZ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.73 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|