C18H20Cl2LiO2P — CID 173243447
lithium;(2,6-dichlorophenyl)-[4-(3-methylbutoxy)phenyl]phosphanylmethanone;hydride (PubChem CID 173243447) has the molecular formula C18H20Cl2LiO2P and a molecular weight of 377.18 g/mol. Its IUPAC name is lithium;(2,6-dichlorophenyl)-[4-(3-methylbutoxy)phenyl]phosphanylmethanone;hydride.
| Compound Name | lithium;(2,6-dichlorophenyl)-[4-(3-methylbutoxy)phenyl]phosphanylmethanone;hydride |
|---|---|
| PubChem CID | 173243447 |
| Molecular Formula | C18H20Cl2LiO2P |
| Molecular Weight | 377.18 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | lithium;(2,6-dichlorophenyl)-[4-(3-methylbutoxy)phenyl]phosphanylmethanone;hydride |
| SMILES | CC(C)CCOc1ccc(PC(=O)c2c(Cl)cccc2Cl)cc1.[H-].[Li+] |
| InChI | InChI=1S/C18H19Cl2O2P.Li.H/c1-12(2)10-11-22-13-6-8-14(9-7-13)23-18(21)17-15(19)4-3-5-16(17)20;;/h3-9,12,23H,10-11H2,1-2H3;;/q;+1;-1 |
| InChIKey | OXCUYVIVFIGHFI-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.18 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|