C17H17Cl2O3P — CID 70013626
(2,6-dichlorophenyl)-[4-(1-ethoxyethoxy)phenyl]phosphanylmethanone (PubChem CID 70013626) has the molecular formula C17H17Cl2O3P and a molecular weight of 371.20 g/mol. Its IUPAC name is (2,6-dichlorophenyl)-[4-(1-ethoxyethoxy)phenyl]phosphanylmethanone.
| Compound Name | (2,6-dichlorophenyl)-[4-(1-ethoxyethoxy)phenyl]phosphanylmethanone |
|---|---|
| PubChem CID | 70013626 |
| Molecular Formula | C17H17Cl2O3P |
| Molecular Weight | 371.20 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | (2,6-dichlorophenyl)-[4-(1-ethoxyethoxy)phenyl]phosphanylmethanone |
| SMILES | CCOC(C)Oc1ccc(PC(=O)c2c(Cl)cccc2Cl)cc1 |
| InChI | InChI=1S/C17H17Cl2O3P/c1-3-21-11(2)22-12-7-9-13(10-8-12)23-17(20)16-14(18)5-4-6-15(16)19/h4-11,23H,3H2,1-2H3 |
| InChIKey | MWNMEOAVSSIOIQ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.20 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|