C16H16Cl2LiO3P — CID 173245757
lithium;(2,6-dichlorophenyl)-[4-(1-methoxyethoxy)phenyl]phosphanylmethanone;hydride (PubChem CID 173245757) has the molecular formula C16H16Cl2LiO3P and a molecular weight of 365.12 g/mol. Its IUPAC name is lithium;(2,6-dichlorophenyl)-[4-(1-methoxyethoxy)phenyl]phosphanylmethanone;hydride.
| Compound Name | lithium;(2,6-dichlorophenyl)-[4-(1-methoxyethoxy)phenyl]phosphanylmethanone;hydride |
|---|---|
| PubChem CID | 173245757 |
| Molecular Formula | C16H16Cl2LiO3P |
| Molecular Weight | 365.12 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | lithium;(2,6-dichlorophenyl)-[4-(1-methoxyethoxy)phenyl]phosphanylmethanone;hydride |
| SMILES | COC(C)Oc1ccc(PC(=O)c2c(Cl)cccc2Cl)cc1.[H-].[Li+] |
| InChI | InChI=1S/C16H15Cl2O3P.Li.H/c1-10(20-2)21-11-6-8-12(9-7-11)22-16(19)15-13(17)4-3-5-14(15)18;;/h3-10,22H,1-2H3;;/q;+1;-1 |
| InChIKey | PLXKISZXYQXMDR-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.12 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|