C19H13Cl2LiO2P+ — CID 18514686
lithium (2,6-dichlorophenyl)-(4-phenoxyphenyl)phosphanylmethanone (PubChem CID 18514686) has the molecular formula C19H13Cl2LiO2P+ and a molecular weight of 382.13 g/mol. Its IUPAC name is lithium (2,6-dichlorophenyl)-(4-phenoxyphenyl)phosphanylmethanone.
| Compound Name | lithium (2,6-dichlorophenyl)-(4-phenoxyphenyl)phosphanylmethanone |
|---|---|
| PubChem CID | 18514686 |
| Molecular Formula | C19H13Cl2LiO2P+ |
| Molecular Weight | 382.13 g/mol |
| Exact Mass | 381.02 |
| IUPAC Name | lithium (2,6-dichlorophenyl)-(4-phenoxyphenyl)phosphanylmethanone |
| SMILES | O=C(Pc1ccc(Oc2ccccc2)cc1)c1c(Cl)cccc1Cl.[Li+] |
| InChI | InChI=1S/C19H13Cl2O2P.Li/c20-16-7-4-8-17(21)18(16)19(22)24-15-11-9-14(10-12-15)23-13-5-2-1-3-6-13;/h1-12,24H;/q;+1 |
| InChIKey | HQYIUHREFUUFFP-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.13 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|