C13H9Cl3LiOP — CID 173243395
lithium;hydride;phenylphosphanyl-(2,3,6-trichlorophenyl)methanone (PubChem CID 173243395) has the molecular formula C13H9Cl3LiOP and a molecular weight of 325.49 g/mol. Its IUPAC name is lithium;hydride;phenylphosphanyl-(2,3,6-trichlorophenyl)methanone.
| Compound Name | lithium;hydride;phenylphosphanyl-(2,3,6-trichlorophenyl)methanone |
|---|---|
| PubChem CID | 173243395 |
| Molecular Formula | C13H9Cl3LiOP |
| Molecular Weight | 325.49 g/mol |
| Exact Mass | 323.96 |
| IUPAC Name | lithium;hydride;phenylphosphanyl-(2,3,6-trichlorophenyl)methanone |
| SMILES | O=C(Pc1ccccc1)c1c(Cl)ccc(Cl)c1Cl.[H-].[Li+] |
| InChI | InChI=1S/C13H8Cl3OP.Li.H/c14-9-6-7-10(15)12(16)11(9)13(17)18-8-4-2-1-3-5-8;;/h1-7,18H;;/q;+1;-1 |
| InChIKey | SVYWJQZDWGQZOF-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.49 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|