C25H36LiOP — CID 173245829
lithium;hydride;phenylphosphanyl-(2,4,6-tritert-butylphenyl)methanone (PubChem CID 173245829) has the molecular formula C25H36LiOP and a molecular weight of 390.48 g/mol. Its IUPAC name is lithium;hydride;phenylphosphanyl-(2,4,6-tritert-butylphenyl)methanone.
| Compound Name | lithium;hydride;phenylphosphanyl-(2,4,6-tritert-butylphenyl)methanone |
|---|---|
| PubChem CID | 173245829 |
| Molecular Formula | C25H36LiOP |
| Molecular Weight | 390.48 g/mol |
| Exact Mass | 390.27 |
| IUPAC Name | lithium;hydride;phenylphosphanyl-(2,4,6-tritert-butylphenyl)methanone |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(C(=O)Pc2ccccc2)c(C(C)(C)C)c1.[H-].[Li+] |
| InChI | InChI=1S/C25H35OP.Li.H/c1-23(2,3)17-15-19(24(4,5)6)21(20(16-17)25(7,8)9)22(26)27-18-13-11-10-12-14-18;;/h10-16,27H,1-9H3;;/q;+1;-1 |
| InChIKey | BVMHFDNHWDFWQU-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.48 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|