C23H39LiOP — CID 159036901
CID 159036901 (PubChem CID 159036901) has the molecular formula C23H39LiOP and a molecular weight of 369.48 g/mol.
| Compound Name | CID 159036901 |
|---|---|
| PubChem CID | 159036901 |
| Molecular Formula | C23H39LiOP |
| Molecular Weight | 369.48 g/mol |
| Exact Mass | 369.29 |
| IUPAC Name | — |
| SMILES | CCC(C)PC(=O)c1c(C(C)(C)C)cc(C(C)(C)C)cc1C(C)(C)C.[Li] |
| InChI | InChI=1S/C23H39OP.Li/c1-12-15(2)25-20(24)19-17(22(6,7)8)13-16(21(3,4)5)14-18(19)23(9,10)11;/h13-15,25H,12H2,1-11H3; |
| InChIKey | JVOMRFCQBQWACZ-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.48 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|