C22H34ClOP — CID 134920180
1-chloro-1-(2,4,6-tritert-butylphenyl)phosphanylidenebutan-2-one (PubChem CID 134920180) has the molecular formula C22H34ClOP and a molecular weight of 380.94 g/mol. Its IUPAC name is 1-chloro-1-(2,4,6-tritert-butylphenyl)phosphanylidenebutan-2-one.
| Compound Name | 1-chloro-1-(2,4,6-tritert-butylphenyl)phosphanylidenebutan-2-one |
|---|---|
| PubChem CID | 134920180 |
| Molecular Formula | C22H34ClOP |
| Molecular Weight | 380.94 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 1-chloro-1-(2,4,6-tritert-butylphenyl)phosphanylidenebutan-2-one |
| SMILES | CCC(=O)/C(Cl)=P/c1c(C(C)(C)C)cc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C22H34ClOP/c1-11-17(24)19(23)25-18-15(21(5,6)7)12-14(20(2,3)4)13-16(18)22(8,9)10/h12-13H,11H2,1-10H3 |
| InChIKey | SCJBFAJYJIIXSV-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.94 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|