C40H64P2 — CID 101184918
(2,4,6-tritert-butylphenyl)-[4-(2,4,6-tritert-butylphenyl)phosphanylidenebutylidene]phosphane (PubChem CID 101184918) has the molecular formula C40H64P2 and a molecular weight of 606.90 g/mol. Its IUPAC name is (2,4,6-tritert-butylphenyl)-[4-(2,4,6-tritert-butylphenyl)phosphanylidenebutylidene]phosphane.
| Compound Name | (2,4,6-tritert-butylphenyl)-[4-(2,4,6-tritert-butylphenyl)phosphanylidenebutylidene]phosphane |
|---|---|
| PubChem CID | 101184918 |
| Molecular Formula | C40H64P2 |
| Molecular Weight | 606.90 g/mol |
| Exact Mass | 606.45 |
| IUPAC Name | (2,4,6-tritert-butylphenyl)-[4-(2,4,6-tritert-butylphenyl)phosphanylidenebutylidene]phosphane |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(/P=C/CC/C=P/c2c(C(C)(C)C)cc(C(C)(C)C)cc2C(C)(C)C)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C40H64P2/c1-35(2,3)27-23-29(37(7,8)9)33(30(24-27)38(10,11)12)41-21-19-20-22-42-34-31(39(13,14)15)25-28(36(4,5)6)26-32(34)40(16,17)18/h21-26H,19-20H2,1-18H3 |
| InChIKey | NUPUWUOPELTAFB-UHFFFAOYSA-N |
| XLogP | 11.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.90 |
| LogP ≤ 5 | 11.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|