C54H87NP2 — CID 134886122
2,4,6-tritert-butyl-N-(2,4,6-tritert-butylphenyl)-N-(2,4,6-tritert-butylphenyl)phosphanylidenephosphanylaniline (PubChem CID 134886122) has the molecular formula C54H87NP2 and a molecular weight of 812.24 g/mol. Its IUPAC name is 2,4,6-tritert-butyl-N-(2,4,6-tritert-butylphenyl)-N-(2,4,6-tritert-butylphenyl)phosphanylidenephosphanylaniline.
| Compound Name | 2,4,6-tritert-butyl-N-(2,4,6-tritert-butylphenyl)-N-(2,4,6-tritert-butylphenyl)phosphanylidenephosphanylaniline |
|---|---|
| PubChem CID | 134886122 |
| Molecular Formula | C54H87NP2 |
| Molecular Weight | 812.24 g/mol |
| Exact Mass | 811.63 |
| IUPAC Name | 2,4,6-tritert-butyl-N-(2,4,6-tritert-butylphenyl)-N-(2,4,6-tritert-butylphenyl)phosphanylidenephosphanylaniline |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(/P=P/N(c2c(C(C)(C)C)cc(C(C)(C)C)cc2C(C)(C)C)c2c(C(C)(C)C)cc(C(C)(C)C)cc2C(C)(C)C)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C54H87NP2/c1-46(2,3)34-28-37(49(10,11)12)43(38(29-34)50(13,14)15)55(44-39(51(16,17)18)30-35(47(4,5)6)31-40(44)52(19,20)21)57-56-45-41(53(22,23)24)32-36(48(7,8)9)33-42(45)54(25,26)27/h28-33H,1-27H3 |
| InChIKey | CBPJOYXNLVIRNU-UHFFFAOYSA-N |
| XLogP | 17.55 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.24 |
| LogP ≤ 5 | 17.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|