C18H30NO2- — CID 163168730
N-oxido-N-(2,4,6-tritert-butylphenyl)hydroxylamine (PubChem CID 163168730) has the molecular formula C18H30NO2- and a molecular weight of 292.44 g/mol. Its IUPAC name is N-oxido-N-(2,4,6-tritert-butylphenyl)hydroxylamine.
| Compound Name | N-oxido-N-(2,4,6-tritert-butylphenyl)hydroxylamine |
|---|---|
| PubChem CID | 163168730 |
| Molecular Formula | C18H30NO2- |
| Molecular Weight | 292.44 g/mol |
| Exact Mass | 292.23 |
| IUPAC Name | N-oxido-N-(2,4,6-tritert-butylphenyl)hydroxylamine |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(N([O-])O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C18H30NO2/c1-16(2,3)12-10-13(17(4,5)6)15(19(20)21)14(11-12)18(7,8)9/h10-11,20H,1-9H3/q-1 |
| InChIKey | LUASEOVWFCNHJB-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.44 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|