C43H64O — CID 155667847
tris(3,4-ditert-butylphenyl)methanol (PubChem CID 155667847) has the molecular formula C43H64O and a molecular weight of 596.98 g/mol. Its IUPAC name is tris(3,4-ditert-butylphenyl)methanol.
| Compound Name | tris(3,4-ditert-butylphenyl)methanol |
|---|---|
| PubChem CID | 155667847 |
| Molecular Formula | C43H64O |
| Molecular Weight | 596.98 g/mol |
| Exact Mass | 596.50 |
| IUPAC Name | tris(3,4-ditert-butylphenyl)methanol |
| SMILES | CC(C)(C)c1ccc(C(O)(c2ccc(C(C)(C)C)c(C(C)(C)C)c2)c2ccc(C(C)(C)C)c(C(C)(C)C)c2)cc1C(C)(C)C |
| InChI | InChI=1S/C43H64O/c1-37(2,3)31-22-19-28(25-34(31)40(10,11)12)43(44,29-20-23-32(38(4,5)6)35(26-29)41(13,14)15)30-21-24-33(39(7,8)9)36(27-30)42(16,17)18/h19-27,44H,1-18H3 |
| InChIKey | DKOUDBVHOBNACY-UHFFFAOYSA-N |
| XLogP | 11.76 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.98 |
| LogP ≤ 5 | 11.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|