About tris(3,4-ditert-butylphenyl)methanol
tris(3,4-ditert-butylphenyl)methanol (PubChem CID 155667847) has the molecular formula C43H64O
and a molecular weight of 596.98 g/mol. Its IUPAC name is tris(3,4-ditert-butylphenyl)methanol.
Molecular Properties
| Compound Name | tris(3,4-ditert-butylphenyl)methanol |
| PubChem CID | 155667847 |
| Molecular Formula | C43H64O |
| Molecular Weight | 596.98 g/mol |
| Exact Mass | 596.50 |
| IUPAC Name | tris(3,4-ditert-butylphenyl)methanol |
| SMILES | CC(C)(C)c1ccc(C(O)(c2ccc(C(C)(C)C)c(C(C)(C)C)c2)c2ccc(C(C)(C)C)c(C(C)(C)C)c2)cc1C(C)(C)C |
| InChI | InChI=1S/C43H64O/c1-37(2,3)31-22-19-28(25-34(31)40(10,11)12)43(44,29-20-23-32(38(4,5)6)35(26-29)41(13,14)15)30-21-24-33(39(7,8)9)36(27-30)42(16,17)18/h19-27,44H,1-18H3 |
| InChIKey | DKOUDBVHOBNACY-UHFFFAOYSA-N |
| XLogP | 11.76 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 596.98 |
| LogP ≤ 5 | 11.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze tris(3,4-ditert-butylphenyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris(3,4-ditert-butylphenyl)methanol?
The IUPAC name of tris(3,4-ditert-butylphenyl)methanol (CID 155667847) is tris(3,4-ditert-butylphenyl)methanol.
What is the SMILES notation for tris(3,4-ditert-butylphenyl)methanol?
The canonical SMILES for tris(3,4-ditert-butylphenyl)methanol is CC(C)(C)c1ccc(C(O)(c2ccc(C(C)(C)C)c(C(C)(C)C)c2)c2ccc(C(C)(C)C)c(C(C)(C)C)c2)cc1C(C)(C)C.
What is the InChIKey of tris(3,4-ditert-butylphenyl)methanol?
The InChIKey is DKOUDBVHOBNACY-UHFFFAOYSA-N. The full InChI is InChI=1S/C43H64O/c1-37(2,3)31-22-19-28(25-34(31)40(10,11)12)43(44,29-20-23-32(38(4,5)6)35(26-29)41(13,14)15)30-21-24-33(39(7,8)9)36(27-30)42(16,17)18/h19-27,44H,1-18H3.
What are the key properties of tris(3,4-ditert-butylphenyl)methanol?
tris(3,4-ditert-butylphenyl)methanol has a molecular weight of 596.98 g/mol, XLogP of 11.76, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tris(3,4-ditert-butylphenyl)methanol is sourced from PubChem (CID 155667847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).