C22H38 — CID 18679123
1,2,3,5-tetratert-butylbenzene (PubChem CID 18679123) has the molecular formula C22H38 and a molecular weight of 302.55 g/mol. Its IUPAC name is 1,2,3,5-tetratert-butylbenzene.
| Compound Name | 1,2,3,5-tetratert-butylbenzene |
|---|---|
| PubChem CID | 18679123 |
| Molecular Formula | C22H38 |
| Molecular Weight | 302.55 g/mol |
| Exact Mass | 302.30 |
| IUPAC Name | 1,2,3,5-tetratert-butylbenzene |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(C(C)(C)C)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C22H38/c1-19(2,3)15-13-16(20(4,5)6)18(22(10,11)12)17(14-15)21(7,8)9/h13-14H,1-12H3 |
| InChIKey | XJGJOIQRBZVSFH-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.55 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |