C54H90GaN3 — CID 16709454
N-bis(2,4,6-tritert-butylanilino)gallanyl-2,4,6-tritert-butylaniline (PubChem CID 16709454) has the molecular formula C54H90GaN3 and a molecular weight of 851.06 g/mol. Its IUPAC name is N-bis(2,4,6-tritert-butylanilino)gallanyl-2,4,6-tritert-butylaniline.
| Compound Name | N-bis(2,4,6-tritert-butylanilino)gallanyl-2,4,6-tritert-butylaniline |
|---|---|
| PubChem CID | 16709454 |
| Molecular Formula | C54H90GaN3 |
| Molecular Weight | 851.06 g/mol |
| Exact Mass | 849.64 |
| IUPAC Name | N-bis(2,4,6-tritert-butylanilino)gallanyl-2,4,6-tritert-butylaniline |
| SMILES | CC(C)(C)c1cc(C(C)(C)C)c(N[Ga](Nc2c(C(C)(C)C)cc(C(C)(C)C)cc2C(C)(C)C)Nc2c(C(C)(C)C)cc(C(C)(C)C)cc2C(C)(C)C)c(C(C)(C)C)c1 |
| InChI | InChI=1S/3C18H30N.Ga/c3*1-16(2,3)12-10-13(17(4,5)6)15(19)14(11-12)18(7,8)9;/h3*10-11,19H,1-9H3;/q3*-1;+3 |
| InChIKey | ZANBRSYLOYISJR-UHFFFAOYSA-N |
| XLogP | 15.99 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.06 |
| LogP ≤ 5 | 15.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |