C26H47B — CID 164988762
ditert-butyl-(2,4,6-tritert-butylphenyl)borane (PubChem CID 164988762) has the molecular formula C26H47B and a molecular weight of 370.47 g/mol. Its IUPAC name is ditert-butyl-(2,4,6-tritert-butylphenyl)borane.
| Compound Name | ditert-butyl-(2,4,6-tritert-butylphenyl)borane |
|---|---|
| PubChem CID | 164988762 |
| Molecular Formula | C26H47B |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.38 |
| IUPAC Name | ditert-butyl-(2,4,6-tritert-butylphenyl)borane |
| SMILES | CC(C)(C)B(c1c(C(C)(C)C)cc(C(C)(C)C)cc1C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C26H47B/c1-22(2,3)18-16-19(23(4,5)6)21(20(17-18)24(7,8)9)27(25(10,11)12)26(13,14)15/h16-17H,1-15H3 |
| InChIKey | JXOVXKWLTUVHHR-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|