C15H25N — CID 143364631
3,5-ditert-butyl-2-methylaniline (PubChem CID 143364631) has the molecular formula C15H25N and a molecular weight of 219.37 g/mol. Its IUPAC name is 3,5-ditert-butyl-2-methylaniline.
| Compound Name | 3,5-ditert-butyl-2-methylaniline |
|---|---|
| PubChem CID | 143364631 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | 3,5-ditert-butyl-2-methylaniline |
| SMILES | Cc1c(N)cc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C15H25N/c1-10-12(15(5,6)7)8-11(9-13(10)16)14(2,3)4/h8-9H,16H2,1-7H3 |
| InChIKey | HMMDYXWEKHGJHW-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|