C16H27NO — CID 146198086
2-(2-amino-4,6-ditert-butylphenyl)ethanol (PubChem CID 146198086) has the molecular formula C16H27NO and a molecular weight of 249.40 g/mol. Its IUPAC name is 2-(2-amino-4,6-ditert-butylphenyl)ethanol.
| Compound Name | 2-(2-amino-4,6-ditert-butylphenyl)ethanol |
|---|---|
| PubChem CID | 146198086 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | 2-(2-amino-4,6-ditert-butylphenyl)ethanol |
| SMILES | CC(C)(C)c1cc(N)c(CCO)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C16H27NO/c1-15(2,3)11-9-13(16(4,5)6)12(7-8-18)14(17)10-11/h9-10,18H,7-8,17H2,1-6H3 |
| InChIKey | RGZLAMBQKCBCHY-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|