C18H31N — CID 167227063
2-butyl-4,6-ditert-butylaniline (PubChem CID 167227063) has the molecular formula C18H31N and a molecular weight of 261.45 g/mol. Its IUPAC name is 2-butyl-4,6-ditert-butylaniline.
| Compound Name | 2-butyl-4,6-ditert-butylaniline |
|---|---|
| PubChem CID | 167227063 |
| Molecular Formula | C18H31N |
| Molecular Weight | 261.45 g/mol |
| Exact Mass | 261.25 |
| IUPAC Name | 2-butyl-4,6-ditert-butylaniline |
| SMILES | CCCCc1cc(C(C)(C)C)cc(C(C)(C)C)c1N |
| InChI | InChI=1S/C18H31N/c1-8-9-10-13-11-14(17(2,3)4)12-15(16(13)19)18(5,6)7/h11-12H,8-10,19H2,1-7H3 |
| InChIKey | HDCOGMVFBUIROG-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.45 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|