C34H44F12N2 — CID 172550499
4-[6-(4-amino-3-butan-2-yl-5-butylphenyl)-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexyl]-2-butan-2-yl-6-butylaniline (PubChem CID 172550499) has the molecular formula C34H44F12N2 and a molecular weight of 708.72 g/mol. Its IUPAC name is 4-[6-(4-amino-3-butan-2-yl-5-butylphenyl)-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexyl]-2-butan-2-yl-6-butylaniline.
| Compound Name | 4-[6-(4-amino-3-butan-2-yl-5-butylphenyl)-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexyl]-2-butan-2-yl-6-butylaniline |
|---|---|
| PubChem CID | 172550499 |
| Molecular Formula | C34H44F12N2 |
| Molecular Weight | 708.72 g/mol |
| Exact Mass | 708.33 |
| IUPAC Name | 4-[6-(4-amino-3-butan-2-yl-5-butylphenyl)-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexyl]-2-butan-2-yl-6-butylaniline |
| SMILES | CCCCc1cc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)c2cc(CCCC)c(N)c(C(C)CC)c2)cc(C(C)CC)c1N |
| InChI | InChI=1S/C34H44F12N2/c1-7-11-13-21-15-23(17-25(27(21)47)19(5)9-3)29(35,36)31(39,40)33(43,44)34(45,46)32(41,42)30(37,38)24-16-22(14-12-8-2)28(48)26(18-24)20(6)10-4/h15-20H,7-14,47-48H2,1-6H3 |
| InChIKey | MULAWIUJZJQUNU-UHFFFAOYSA-N |
| XLogP | 11.99 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 708.72 |
| LogP ≤ 5 | 11.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|