About 1-butan-2-yl-2-butylbenzene;ethane;propane
1-butan-2-yl-2-butylbenzene;ethane;propane (PubChem CID 144927563) has the molecular formula C19H36
and a molecular weight of 264.50 g/mol. Its IUPAC name is 1-butan-2-yl-2-butylbenzene;ethane;propane.
Molecular Properties
| Compound Name | 1-butan-2-yl-2-butylbenzene;ethane;propane |
| PubChem CID | 144927563 |
| Molecular Formula | C19H36 |
| Molecular Weight | 264.50 g/mol |
| Exact Mass | 264.28 |
| IUPAC Name | 1-butan-2-yl-2-butylbenzene;ethane;propane |
| SMILES | CC.CCC.CCCCc1ccccc1C(C)CC |
| InChI | InChI=1S/C14H22.C3H8.C2H6/c1-4-6-9-13-10-7-8-11-14(13)12(3)5-2;1-3-2;1-2/h7-8,10-12H,4-6,9H2,1-3H3;3H2,1-2H3;1-2H3 |
| InChIKey | OCOWWOZGHWGNBM-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 264.50 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-butan-2-yl-2-butylbenzene;ethane;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butan-2-yl-2-butylbenzene;ethane;propane?
The IUPAC name of 1-butan-2-yl-2-butylbenzene;ethane;propane (CID 144927563) is 1-butan-2-yl-2-butylbenzene;ethane;propane.
What is the SMILES notation for 1-butan-2-yl-2-butylbenzene;ethane;propane?
The canonical SMILES for 1-butan-2-yl-2-butylbenzene;ethane;propane is CC.CCC.CCCCc1ccccc1C(C)CC.
What is the InChIKey of 1-butan-2-yl-2-butylbenzene;ethane;propane?
The InChIKey is OCOWWOZGHWGNBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22.C3H8.C2H6/c1-4-6-9-13-10-7-8-11-14(13)12(3)5-2;1-3-2;1-2/h7-8,10-12H,4-6,9H2,1-3H3;3H2,1-2H3;1-2H3.
What are the key properties of 1-butan-2-yl-2-butylbenzene;ethane;propane?
1-butan-2-yl-2-butylbenzene;ethane;propane has a molecular weight of 264.50 g/mol, XLogP of 6.99, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butan-2-yl-2-butylbenzene;ethane;propane is sourced from PubChem (CID 144927563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).