C36H60N2O — CID 150650015
4-(4-amino-2,3,5-tributylphenoxy)-2,3,6-tributylaniline (PubChem CID 150650015) has the molecular formula C36H60N2O and a molecular weight of 536.89 g/mol. Its IUPAC name is 4-(4-amino-2,3,5-tributylphenoxy)-2,3,6-tributylaniline.
| Compound Name | 4-(4-amino-2,3,5-tributylphenoxy)-2,3,6-tributylaniline |
|---|---|
| PubChem CID | 150650015 |
| Molecular Formula | C36H60N2O |
| Molecular Weight | 536.89 g/mol |
| Exact Mass | 536.47 |
| IUPAC Name | 4-(4-amino-2,3,5-tributylphenoxy)-2,3,6-tributylaniline |
| SMILES | CCCCc1cc(Oc2cc(CCCC)c(N)c(CCCC)c2CCCC)c(CCCC)c(CCCC)c1N |
| InChI | InChI=1S/C36H60N2O/c1-7-13-19-27-25-33(29(21-15-9-3)31(35(27)37)23-17-11-5)39-34-26-28(20-14-8-2)36(38)32(24-18-12-6)30(34)22-16-10-4/h25-26H,7-24,37-38H2,1-6H3 |
| InChIKey | JBRDWBKHHUYMMX-UHFFFAOYSA-N |
| XLogP | 10.70 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.89 |
| LogP ≤ 5 | 10.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|