C14H22N4 — CID 174872373
5,6-dibutyl-2H-benzotriazol-4-amine (PubChem CID 174872373) has the molecular formula C14H22N4 and a molecular weight of 246.36 g/mol. Its IUPAC name is 5,6-dibutyl-2H-benzotriazol-4-amine.
| Compound Name | 5,6-dibutyl-2H-benzotriazol-4-amine |
|---|---|
| PubChem CID | 174872373 |
| Molecular Formula | C14H22N4 |
| Molecular Weight | 246.36 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | 5,6-dibutyl-2H-benzotriazol-4-amine |
| SMILES | CCCCc1cc2n[nH]nc2c(N)c1CCCC |
| InChI | InChI=1S/C14H22N4/c1-3-5-7-10-9-12-14(17-18-16-12)13(15)11(10)8-6-4-2/h9H,3-8,15H2,1-2H3,(H,16,17,18) |
| InChIKey | BSPZFYZMBNDNIG-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.36 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|