C24H42N4 — CID 162023137
2-[5,6-bis(2-ethylhexyl)-2H-benzotriazol-4-yl]ethanamine (PubChem CID 162023137) has the molecular formula C24H42N4 and a molecular weight of 386.63 g/mol. Its IUPAC name is 2-[5,6-bis(2-ethylhexyl)-2H-benzotriazol-4-yl]ethanamine.
| Compound Name | 2-[5,6-bis(2-ethylhexyl)-2H-benzotriazol-4-yl]ethanamine |
|---|---|
| PubChem CID | 162023137 |
| Molecular Formula | C24H42N4 |
| Molecular Weight | 386.63 g/mol |
| Exact Mass | 386.34 |
| IUPAC Name | 2-[5,6-bis(2-ethylhexyl)-2H-benzotriazol-4-yl]ethanamine |
| SMILES | CCCCC(CC)Cc1cc2n[nH]nc2c(CCN)c1CC(CC)CCCC |
| InChI | InChI=1S/C24H42N4/c1-5-9-11-18(7-3)15-20-17-23-24(27-28-26-23)21(13-14-25)22(20)16-19(8-4)12-10-6-2/h17-19H,5-16,25H2,1-4H3,(H,26,27,28) |
| InChIKey | YUZWYSJVXOQGIH-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.63 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |