C12H22N2 — CID 91421970
3,4-dibutyl-1H-pyrrol-2-amine (PubChem CID 91421970) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is 3,4-dibutyl-1H-pyrrol-2-amine.
| Compound Name | 3,4-dibutyl-1H-pyrrol-2-amine |
|---|---|
| PubChem CID | 91421970 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | 3,4-dibutyl-1H-pyrrol-2-amine |
| SMILES | CCCCc1c[nH]c(N)c1CCCC |
| InChI | InChI=1S/C12H22N2/c1-3-5-7-10-9-14-12(13)11(10)8-6-4-2/h9,14H,3-8,13H2,1-2H3 |
| InChIKey | QCXSTIZFEUDVMQ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |