C12H22NP — CID 91386748
3,4-dibutyl-1H-phosphol-2-amine (PubChem CID 91386748) has the molecular formula C12H22NP and a molecular weight of 211.29 g/mol. Its IUPAC name is 3,4-dibutyl-1H-phosphol-2-amine.
| Compound Name | 3,4-dibutyl-1H-phosphol-2-amine |
|---|---|
| PubChem CID | 91386748 |
| Molecular Formula | C12H22NP |
| Molecular Weight | 211.29 g/mol |
| Exact Mass | 211.15 |
| IUPAC Name | 3,4-dibutyl-1H-phosphol-2-amine |
| SMILES | CCCCc1c[pH]c(N)c1CCCC |
| InChI | InChI=1S/C12H22NP/c1-3-5-7-10-9-14-12(13)11(10)8-6-4-2/h9,14H,3-8,13H2,1-2H3 |
| InChIKey | SJBQLECRKGNWPB-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.29 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |