C12H22P2 — CID 173084959
(3,4-dibutyl-1H-phosphol-2-yl)phosphane (PubChem CID 173084959) has the molecular formula C12H22P2 and a molecular weight of 228.26 g/mol. Its IUPAC name is (3,4-dibutyl-1H-phosphol-2-yl)phosphane.
| Compound Name | (3,4-dibutyl-1H-phosphol-2-yl)phosphane |
|---|---|
| PubChem CID | 173084959 |
| Molecular Formula | C12H22P2 |
| Molecular Weight | 228.26 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | (3,4-dibutyl-1H-phosphol-2-yl)phosphane |
| SMILES | CCCCc1c[pH]c(P)c1CCCC |
| InChI | InChI=1S/C12H22P2/c1-3-5-7-10-9-14-12(13)11(10)8-6-4-2/h9,14H,3-8,13H2,1-2H3 |
| InChIKey | HYDUGWVHSWYTEN-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.26 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|