C45H69NO3 — CID 123257913
2-[[bis[(2,4-ditert-butyl-6-hydroxyphenyl)methyl]amino]methyl]-3,5-ditert-butylphenol (PubChem CID 123257913) has the molecular formula C45H69NO3 and a molecular weight of 672.05 g/mol. Its IUPAC name is 2-[[bis[(2,4-ditert-butyl-6-hydroxyphenyl)methyl]amino]methyl]-3,5-ditert-butylphenol.
| Compound Name | 2-[[bis[(2,4-ditert-butyl-6-hydroxyphenyl)methyl]amino]methyl]-3,5-ditert-butylphenol |
|---|---|
| PubChem CID | 123257913 |
| Molecular Formula | C45H69NO3 |
| Molecular Weight | 672.05 g/mol |
| Exact Mass | 671.53 |
| IUPAC Name | 2-[[bis[(2,4-ditert-butyl-6-hydroxyphenyl)methyl]amino]methyl]-3,5-ditert-butylphenol |
| SMILES | CC(C)(C)c1cc(O)c(CN(Cc2c(O)cc(C(C)(C)C)cc2C(C)(C)C)Cc2c(O)cc(C(C)(C)C)cc2C(C)(C)C)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C45H69NO3/c1-40(2,3)28-19-34(43(10,11)12)31(37(47)22-28)25-46(26-32-35(44(13,14)15)20-29(23-38(32)48)41(4,5)6)27-33-36(45(16,17)18)21-30(24-39(33)49)42(7,8)9/h19-24,47-49H,25-27H2,1-18H3 |
| InChIKey | UWCHENVLDYQHPU-UHFFFAOYSA-N |
| XLogP | 11.79 |
| TPSA | 63.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.05 |
| LogP ≤ 5 | 11.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|