C34H56N2O2 — CID 100954422
3,5-ditert-butyl-2-[[(2,4-ditert-butyl-6-hydroxyphenyl)methyl-[2-(dimethylamino)ethyl]amino]methyl]phenol (PubChem CID 100954422) has the molecular formula C34H56N2O2 and a molecular weight of 524.83 g/mol. Its IUPAC name is 3,5-ditert-butyl-2-[[(2,4-ditert-butyl-6-hydroxyphenyl)methyl-[2-(dimethylamino)ethyl]amino]methyl]phenol.
| Compound Name | 3,5-ditert-butyl-2-[[(2,4-ditert-butyl-6-hydroxyphenyl)methyl-[2-(dimethylamino)ethyl]amino]methyl]phenol |
|---|---|
| PubChem CID | 100954422 |
| Molecular Formula | C34H56N2O2 |
| Molecular Weight | 524.83 g/mol |
| Exact Mass | 524.43 |
| IUPAC Name | 3,5-ditert-butyl-2-[[(2,4-ditert-butyl-6-hydroxyphenyl)methyl-[2-(dimethylamino)ethyl]amino]methyl]phenol |
| SMILES | CN(C)CCN(Cc1c(O)cc(C(C)(C)C)cc1C(C)(C)C)Cc1c(O)cc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C34H56N2O2/c1-31(2,3)23-17-27(33(7,8)9)25(29(37)19-23)21-36(16-15-35(13)14)22-26-28(34(10,11)12)18-24(20-30(26)38)32(4,5)6/h17-20,37-38H,15-16,21-22H2,1-14H3 |
| InChIKey | QAWGKWRSOYYOJL-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.83 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|