C25H47N3O — CID 30981664
2-[[bis[3-(dimethylamino)propyl]amino]methyl]-4,6-ditert-butylphenol (PubChem CID 30981664) has the molecular formula C25H47N3O and a molecular weight of 405.67 g/mol. Its IUPAC name is 2-[[bis[3-(dimethylamino)propyl]amino]methyl]-4,6-ditert-butylphenol.
| Compound Name | 2-[[bis[3-(dimethylamino)propyl]amino]methyl]-4,6-ditert-butylphenol |
|---|---|
| PubChem CID | 30981664 |
| Molecular Formula | C25H47N3O |
| Molecular Weight | 405.67 g/mol |
| Exact Mass | 405.37 |
| IUPAC Name | 2-[[bis[3-(dimethylamino)propyl]amino]methyl]-4,6-ditert-butylphenol |
| SMILES | CN(C)CCCN(CCCN(C)C)Cc1cc(C(C)(C)C)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C25H47N3O/c1-24(2,3)21-17-20(23(29)22(18-21)25(4,5)6)19-28(15-11-13-26(7)8)16-12-14-27(9)10/h17-18,29H,11-16,19H2,1-10H3 |
| InChIKey | OZONTOQRNWPNED-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 29.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.67 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|