C35H51NO2S — CID 102048603
2,4-ditert-butyl-6-[[(3,5-ditert-butyl-2-hydroxyphenyl)methyl-(thiophen-2-ylmethyl)amino]methyl]phenol (PubChem CID 102048603) has the molecular formula C35H51NO2S and a molecular weight of 549.87 g/mol. Its IUPAC name is 2,4-ditert-butyl-6-[[(3,5-ditert-butyl-2-hydroxyphenyl)methyl-(thiophen-2-ylmethyl)amino]methyl]phenol.
| Compound Name | 2,4-ditert-butyl-6-[[(3,5-ditert-butyl-2-hydroxyphenyl)methyl-(thiophen-2-ylmethyl)amino]methyl]phenol |
|---|---|
| PubChem CID | 102048603 |
| Molecular Formula | C35H51NO2S |
| Molecular Weight | 549.87 g/mol |
| Exact Mass | 549.36 |
| IUPAC Name | 2,4-ditert-butyl-6-[[(3,5-ditert-butyl-2-hydroxyphenyl)methyl-(thiophen-2-ylmethyl)amino]methyl]phenol |
| SMILES | CC(C)(C)c1cc(CN(Cc2cccs2)Cc2cc(C(C)(C)C)cc(C(C)(C)C)c2O)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C35H51NO2S/c1-32(2,3)25-16-23(30(37)28(18-25)34(7,8)9)20-36(22-27-14-13-15-39-27)21-24-17-26(33(4,5)6)19-29(31(24)38)35(10,11)12/h13-19,37-38H,20-22H2,1-12H3 |
| InChIKey | PMAAMMFVRPLVFP-UHFFFAOYSA-N |
| XLogP | 9.55 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.87 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|