C18H24ClNO2S — CID 14751263
[3-tert-butyl-5-[(dimethylamino)methyl]-4-hydroxyphenyl]-thiophen-2-ylmethanone;hydrochloride (PubChem CID 14751263) has the molecular formula C18H24ClNO2S and a molecular weight of 353.92 g/mol. Its IUPAC name is [3-tert-butyl-5-[(dimethylamino)methyl]-4-hydroxyphenyl]-thiophen-2-ylmethanone;hydrochloride.
| Compound Name | [3-tert-butyl-5-[(dimethylamino)methyl]-4-hydroxyphenyl]-thiophen-2-ylmethanone;hydrochloride |
|---|---|
| PubChem CID | 14751263 |
| Molecular Formula | C18H24ClNO2S |
| Molecular Weight | 353.92 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | [3-tert-butyl-5-[(dimethylamino)methyl]-4-hydroxyphenyl]-thiophen-2-ylmethanone;hydrochloride |
| SMILES | CN(C)Cc1cc(C(=O)c2cccs2)cc(C(C)(C)C)c1O.Cl |
| InChI | InChI=1S/C18H23NO2S.ClH/c1-18(2,3)14-10-12(17(21)15-7-6-8-22-15)9-13(16(14)20)11-19(4)5;/h6-10,20H,11H2,1-5H3;1H |
| InChIKey | SKLCKIWFHYTILB-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.92 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|