C25H31NO6S2 — CID 14751228
benzenesulfonic acid;[3-tert-butyl-4-hydroxy-5-[[2-hydroxyethyl(methyl)amino]methyl]phenyl]-thiophen-2-ylmethanone (PubChem CID 14751228) has the molecular formula C25H31NO6S2 and a molecular weight of 505.66 g/mol. Its IUPAC name is benzenesulfonic acid;[3-tert-butyl-4-hydroxy-5-[[2-hydroxyethyl(methyl)amino]methyl]phenyl]-thiophen-2-ylmethanone.
| Compound Name | benzenesulfonic acid;[3-tert-butyl-4-hydroxy-5-[[2-hydroxyethyl(methyl)amino]methyl]phenyl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 14751228 |
| Molecular Formula | C25H31NO6S2 |
| Molecular Weight | 505.66 g/mol |
| Exact Mass | 505.16 |
| IUPAC Name | benzenesulfonic acid;[3-tert-butyl-4-hydroxy-5-[[2-hydroxyethyl(methyl)amino]methyl]phenyl]-thiophen-2-ylmethanone |
| SMILES | CN(CCO)Cc1cc(C(=O)c2cccs2)cc(C(C)(C)C)c1O.O=S(=O)(O)c1ccccc1 |
| InChI | InChI=1S/C19H25NO3S.C6H6O3S/c1-19(2,3)15-11-13(18(23)16-6-5-9-24-16)10-14(17(15)22)12-20(4)7-8-21;7-10(8,9)6-4-2-1-3-5-6/h5-6,9-11,21-22H,7-8,12H2,1-4H3;1-5H,(H,7,8,9) |
| InChIKey | LXSHCYWBYPTBDW-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 115.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.66 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|