C25H34ClNO2S — CID 14751245
[3-tert-butyl-5-[[cyclohexyl(prop-2-enyl)amino]methyl]-4-hydroxyphenyl]-thiophen-2-ylmethanone;hydrochloride (PubChem CID 14751245) has the molecular formula C25H34ClNO2S and a molecular weight of 448.07 g/mol. Its IUPAC name is [3-tert-butyl-5-[[cyclohexyl(prop-2-enyl)amino]methyl]-4-hydroxyphenyl]-thiophen-2-ylmethanone;hydrochloride.
| Compound Name | [3-tert-butyl-5-[[cyclohexyl(prop-2-enyl)amino]methyl]-4-hydroxyphenyl]-thiophen-2-ylmethanone;hydrochloride |
|---|---|
| PubChem CID | 14751245 |
| Molecular Formula | C25H34ClNO2S |
| Molecular Weight | 448.07 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | [3-tert-butyl-5-[[cyclohexyl(prop-2-enyl)amino]methyl]-4-hydroxyphenyl]-thiophen-2-ylmethanone;hydrochloride |
| SMILES | C=CCN(Cc1cc(C(=O)c2cccs2)cc(C(C)(C)C)c1O)C1CCCCC1.Cl |
| InChI | InChI=1S/C25H33NO2S.ClH/c1-5-13-26(20-10-7-6-8-11-20)17-19-15-18(24(28)22-12-9-14-29-22)16-21(23(19)27)25(2,3)4;/h5,9,12,14-16,20,27H,1,6-8,10-11,13,17H2,2-4H3;1H |
| InChIKey | OKVVZBIZOMBLOV-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.07 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|