C19H31Cl2NOZr — CID 123752097
2-tert-butyl-6-[[cycloheptyl(methyl)amino]methyl]phenol;dichlorozirconium (PubChem CID 123752097) has the molecular formula C19H31Cl2NOZr and a molecular weight of 451.59 g/mol. Its IUPAC name is 2-tert-butyl-6-[[cycloheptyl(methyl)amino]methyl]phenol;dichlorozirconium.
| Compound Name | 2-tert-butyl-6-[[cycloheptyl(methyl)amino]methyl]phenol;dichlorozirconium |
|---|---|
| PubChem CID | 123752097 |
| Molecular Formula | C19H31Cl2NOZr |
| Molecular Weight | 451.59 g/mol |
| Exact Mass | 449.08 |
| IUPAC Name | 2-tert-butyl-6-[[cycloheptyl(methyl)amino]methyl]phenol;dichlorozirconium |
| SMILES | CN(Cc1cccc(C(C)(C)C)c1O)C1CCCCCC1.Cl[Zr]Cl |
| InChI | InChI=1S/C19H31NO.2ClH.Zr/c1-19(2,3)17-13-9-10-15(18(17)21)14-20(4)16-11-7-5-6-8-12-16;;;/h9-10,13,16,21H,5-8,11-12,14H2,1-4H3;2*1H;/q;;;+2/p-2 |
| InChIKey | AUQMRGSNFLHULY-UHFFFAOYSA-L |
| XLogP | 6.22 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.59 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|