C17H25F3N2O — CID 162596407
2-[[cyclohexyl-[2-(methylamino)ethyl]amino]methyl]-6-(trifluoromethyl)phenol (PubChem CID 162596407) has the molecular formula C17H25F3N2O and a molecular weight of 330.39 g/mol. Its IUPAC name is 2-[[cyclohexyl-[2-(methylamino)ethyl]amino]methyl]-6-(trifluoromethyl)phenol.
| Compound Name | 2-[[cyclohexyl-[2-(methylamino)ethyl]amino]methyl]-6-(trifluoromethyl)phenol |
|---|---|
| PubChem CID | 162596407 |
| Molecular Formula | C17H25F3N2O |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | 2-[[cyclohexyl-[2-(methylamino)ethyl]amino]methyl]-6-(trifluoromethyl)phenol |
| SMILES | CNCCN(Cc1cccc(C(F)(F)F)c1O)C1CCCCC1 |
| InChI | InChI=1S/C17H25F3N2O/c1-21-10-11-22(14-7-3-2-4-8-14)12-13-6-5-9-15(16(13)23)17(18,19)20/h5-6,9,14,21,23H,2-4,7-8,10-12H2,1H3 |
| InChIKey | OMWGPOBBGQOPBL-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|