About CID 11225844
CID 11225844 (PubChem CID 11225844) has the molecular formula C24H37Cl2OZr
and a molecular weight of 503.69 g/mol.
Molecular Properties
| Compound Name | CID 11225844 |
| PubChem CID | 11225844 |
| Molecular Formula | C24H37Cl2OZr |
| Molecular Weight | 503.69 g/mol |
| Exact Mass | 501.13 |
| IUPAC Name | — |
| SMILES | CC(C)(C)c1cccc(C(C)(C)C)c1O.C[C]1[C](C)[C](C)[C](C)[C]1C.Cl[Zr]Cl |
| InChI | InChI=1S/C14H22O.C10H15.2ClH.Zr/c1-13(2,3)10-8-7-9-11(12(10)15)14(4,5)6;1-6-7(2)9(4)10(5)8(6)3;;;/h7-9,15H,1-6H3;1-5H3;2*1H;/q;;;;+2/p-2 |
| InChIKey | PIBQQDPQGWAQOQ-UHFFFAOYSA-L |
| XLogP | 8.34 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 503.69 |
| LogP ≤ 5 | 8.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 11225844 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11225844?
The IUPAC name of CID 11225844 (CID 11225844) is not available.
What is the SMILES notation for CID 11225844?
The canonical SMILES for CID 11225844 is CC(C)(C)c1cccc(C(C)(C)C)c1O.C[C]1[C](C)[C](C)[C](C)[C]1C.Cl[Zr]Cl.
What is the InChIKey of CID 11225844?
The InChIKey is PIBQQDPQGWAQOQ-UHFFFAOYSA-L. The full InChI is InChI=1S/C14H22O.C10H15.2ClH.Zr/c1-13(2,3)10-8-7-9-11(12(10)15)14(4,5)6;1-6-7(2)9(4)10(5)8(6)3;;;/h7-9,15H,1-6H3;1-5H3;2*1H;/q;;;;+2/p-2.
What are the key properties of CID 11225844?
CID 11225844 has a molecular weight of 503.69 g/mol, XLogP of 8.34, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11225844 is sourced from PubChem (CID 11225844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).