C28H38Cl2N2O2Zr — CID 139252627
bis(2-tert-butyl-6-(cyclopropyliminomethyl)phenol);dichlorozirconium (PubChem CID 139252627) has the molecular formula C28H38Cl2N2O2Zr and a molecular weight of 596.75 g/mol. Its IUPAC name is bis(2-tert-butyl-6-(cyclopropyliminomethyl)phenol);dichlorozirconium.
| Compound Name | bis(2-tert-butyl-6-(cyclopropyliminomethyl)phenol);dichlorozirconium |
|---|---|
| PubChem CID | 139252627 |
| Molecular Formula | C28H38Cl2N2O2Zr |
| Molecular Weight | 596.75 g/mol |
| Exact Mass | 594.14 |
| IUPAC Name | bis(2-tert-butyl-6-(cyclopropyliminomethyl)phenol);dichlorozirconium |
| SMILES | CC(C)(C)c1cccc(/C=N/C2CC2)c1O.CC(C)(C)c1cccc(/C=N/C2CC2)c1O.Cl[Zr]Cl |
| InChI | InChI=1S/2C14H19NO.2ClH.Zr/c2*1-14(2,3)12-6-4-5-10(13(12)16)9-15-11-7-8-11;;;/h2*4-6,9,11,16H,7-8H2,1-3H3;2*1H;/q;;;;+2/p-2/b2*15-9+;;; |
| InChIKey | UVJXXRFCJVIMOU-BPJWSWEGSA-L |
| XLogP | 7.92 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.75 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|