C19H25Cl2NOSiZr — CID 137095840
2-tert-butyl-6-[[dimethyl(phenyl)silyl]iminomethyl]phenol;dichlorozirconium (PubChem CID 137095840) has the molecular formula C19H25Cl2NOSiZr and a molecular weight of 473.63 g/mol. Its IUPAC name is 2-tert-butyl-6-[[dimethyl(phenyl)silyl]iminomethyl]phenol;dichlorozirconium.
| Compound Name | 2-tert-butyl-6-[[dimethyl(phenyl)silyl]iminomethyl]phenol;dichlorozirconium |
|---|---|
| PubChem CID | 137095840 |
| Molecular Formula | C19H25Cl2NOSiZr |
| Molecular Weight | 473.63 g/mol |
| Exact Mass | 471.01 |
| IUPAC Name | 2-tert-butyl-6-[[dimethyl(phenyl)silyl]iminomethyl]phenol;dichlorozirconium |
| SMILES | CC(C)(C)c1cccc(C=N[Si](C)(C)c2ccccc2)c1O.Cl[Zr]Cl |
| InChI | InChI=1S/C19H25NOSi.2ClH.Zr/c1-19(2,3)17-13-9-10-15(18(17)21)14-20-22(4,5)16-11-7-6-8-12-16;;;/h6-14,21H,1-5H3;2*1H;/q;;;+2/p-2 |
| InChIKey | XUROMOXRJDERDO-UHFFFAOYSA-L |
| XLogP | 5.60 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.63 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|